CAS 876617-07-1 is the registry number for 4,4,5,5-Tetramethyl-2-(4-(propylsulfonyl)phenyl)-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 250mg.
4,4,5,5-tetramethyl-2-(4-propylsulfonylphenyl)-1,3,2-dioxaborolane (CAS 876617-07-1) is a chemical compound with the molecular formula C15H23BO4S and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propylsulfonylphenyl)-1,3,2-dioxaborolane. InChIKey: RTFXMNKQYJXLRE-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propylsulfonylphenyl)-1,3,2-dioxaborolane |
| InChIKey | RTFXMNKQYJXLRE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)CCC |
Computed by PubChem (NCBI)