CAS 2377607-10-6 appears in our catalog under these names: 4-(t-Butoxycarbonyl)thiophene-2-boronic acid pinacol ester, 96%, tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate (CAS 2377607-10-6) is a chemical compound with the molecular formula C15H23BO4S and a molecular weight of 310.2 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate. InChIKey: QQZFEVBLDVDJID-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate |
| InChIKey | QQZFEVBLDVDJID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)