CAS 2377610-28-9 appears in our catalog under these names: 4-[(Ethanesulfonyl)methyl]phenylboronic acid pinacol ester, 96%, 2-(4-((Ethylsulfonyl)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-[4-(ethylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377610-28-9) is a chemical compound with the molecular formula C15H23BO4S and a molecular weight of 310.2 g/mol. IUPAC name: 2-[4-(ethylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UGANQQOTJSMEJZ-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 2-[4-(ethylsulfonylmethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UGANQQOTJSMEJZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CS(=O)(=O)CC |
Computed by PubChem (NCBI)