CAS 2377611-65-7 is the registry number for 3-(Isopropanesulfonyl)phenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4,5,5-tetramethyl-2-(3-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane (CAS 2377611-65-7) is a chemical compound with the molecular formula C15H23BO4S and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane. InChIKey: NHFQKZNVPWZSAS-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-propan-2-ylsulfonylphenyl)-1,3,2-dioxaborolane |
| InChIKey | NHFQKZNVPWZSAS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)C(C)C |
Computed by PubChem (NCBI)