Products 1402174-74-6
CAS 1402174-74-6 is the registry number for 5–(1–Methyl–1–acetoxyethyl)thiophene–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]propan-2-yl acetate (CAS 1402174-74-6) is a chemical compound with the molecular formula C15H23BO4S and a molecular weight of 310.2 g/mol. IUPAC name: 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]propan-2-yl acetate. InChIKey: WXHNMHNSDWJBQT-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]propan-2-yl acetate |
| InChIKey | WXHNMHNSDWJBQT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(C)(C)OC(=O)C |
Computed by PubChem (NCBI)