CAS 1310481-47-0 appears in our catalog under these names: (4-(2-{((tert-Butoxy)carbonyl)amino}ethyl)phenyl)boronic acid, (4-(2-((tert-Butoxycarbonyl)amino)ethyl)phenyl)boronic acid, 95%, 95%, (4-(2-((tert-Butoxycarbonyl)amino)ethyl)phenyl)boronic acid, 97%, (4-(2-((tert-Butoxycarbonyl)amino)ethyl)phenyl)boronic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g, 10g.
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid (CAS 1310481-47-0) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid. InChIKey: KNYILTVMRTVCDV-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]boronic acid |
| InChIKey | KNYILTVMRTVCDV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)