CAS 1311314-22-3 is the registry number for 3-(3-Fluorophenyl)cyclobutan-1-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-fluorophenyl)cyclobutan-1-amine;hydrochloride (CAS 1311314-22-3) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 3-(3-fluorophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: HZPYJZOXCJOKMP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 3-(3-fluorophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | HZPYJZOXCJOKMP-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)