Products 1311315-47-5
CAS 1311315-47-5 appears in our catalog under these names: 2-(Dimethylamino)pyridine-4-carboxylic acid hydrochloride, 2-(Dimethylamino)pyridine-4-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
2-(dimethylamino)pyridine-4-carboxylic acid;hydrochloride (CAS 1311315-47-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(dimethylamino)pyridine-4-carboxylic acid;hydrochloride. InChIKey: XJHZBFRSLCFOJF-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(dimethylamino)pyridine-4-carboxylic acid;hydrochloride |
| InChIKey | XJHZBFRSLCFOJF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=CC(=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)