Products 1311315-60-2

CAS 1311315-60-2 is the registry number for Cyclohexyl 4-amino-4-methylpentanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Cyclohexyl 4-amino-4-methylpentanoate;hydrochloride (CAS 1311315-60-2) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: cyclohexyl 4-amino-4-methylpentanoate;hydrochloride. InChIKey: RWQJYGKNTDYFBK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24ClNO2
Molecular weight249.78 g/mol
IUPAC namecyclohexyl 4-amino-4-methylpentanoate;hydrochloride
InChIKeyRWQJYGKNTDYFBK-UHFFFAOYSA-N
SMILESCC(C)(CCC(=O)OC1CCCCC1)N.Cl

Computed by PubChem (NCBI)