CAS 2613385-38-7 is the registry number for tert-Butyl 4-amino-4-methylcyclohexane-1-carboxylate hydrochloride, 97+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl 4-amino-4-methylcyclohexane-1-carboxylate;hydrochloride (CAS 2613385-38-7) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: tert-butyl 4-amino-4-methylcyclohexane-1-carboxylate;hydrochloride. InChIKey: HJDUGZOBOSIOFP-UHFFFAOYSA-N.
| Molecular formula | C12H24ClNO2 |
|---|---|
| Molecular weight | 249.78 g/mol |
| IUPAC name | tert-butyl 4-amino-4-methylcyclohexane-1-carboxylate;hydrochloride |
| InChIKey | HJDUGZOBOSIOFP-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)