Products 38698-16-7

CAS 38698-16-7 is the registry number for tert-Butyl (1R,4R)-4-(aminomethyl)cyclohexane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride (CAS 38698-16-7) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: tert-butyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride. InChIKey: VMJOMRRCIRCARV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24ClNO2
Molecular weight249.78 g/mol
IUPAC nametert-butyl 4-(aminomethyl)cyclohexane-1-carboxylate;hydrochloride
InChIKeyVMJOMRRCIRCARV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1CCC(CC1)CN.Cl

Computed by PubChem (NCBI)