Products 1311317-68-6
CAS 1311317-68-6 appears in our catalog under these names: 7-Fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%, 7-Fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
7-fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1311317-68-6) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 7-fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: LBLPHVVQYMPIHT-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 7-fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | LBLPHVVQYMPIHT-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CCN1)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)