CAS 1311317-85-7 is the registry number for 1-(4-(2H-1,3-Benzodioxol-5-yl)-1H-imidazol-2-yl)ethan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]ethanamine;hydrochloride (CAS 1311317-85-7) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: 1-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]ethanamine;hydrochloride. InChIKey: WZNRZPDARCRXHP-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 1-[5-(1,3-benzodioxol-5-yl)-1H-imidazol-2-yl]ethanamine;hydrochloride |
| InChIKey | WZNRZPDARCRXHP-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(N1)C2=CC3=C(C=C2)OCO3)N.Cl |
Computed by PubChem (NCBI)