CAS 1311318-47-4 appears in our catalog under these names: 2-Amino-2,3-dihydro-1H-indene-2-carboxamide hydrochloride, 95%, 2-Amino-2,3-dihydro-1H-indene-2-carboxamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-1,3-dihydroindene-2-carboxamide;hydrochloride (CAS 1311318-47-4) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 2-amino-1,3-dihydroindene-2-carboxamide;hydrochloride. InChIKey: MYTMKBFTFSVYLY-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 2-amino-1,3-dihydroindene-2-carboxamide;hydrochloride |
| InChIKey | MYTMKBFTFSVYLY-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(C(=O)N)N.Cl |
Computed by PubChem (NCBI)