CAS 131170-39-3 appears in our catalog under these names: 3-(1-Methylcyclopropyl)benzoic acid, 3-(1-Methylcyclopropyl)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-(1-methylcyclopropyl)benzoic acid (CAS 131170-39-3) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-(1-methylcyclopropyl)benzoic acid. InChIKey: FLWNINVYCYHRKV-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-(1-methylcyclopropyl)benzoic acid |
| InChIKey | FLWNINVYCYHRKV-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)