Products 131172-59-3
CAS 131172-59-3 is the registry number for 5-(p-Tolyl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(4-methylphenyl)-1H-pyrrole-2-carboxylic acid (CAS 131172-59-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 5-(4-methylphenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: GUGAOFSHCGOMMW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | GUGAOFSHCGOMMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(N2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-p-Tolyl-1H-pyrrole-2-carboxylic acid, 5-(4-methylphenyl)-1H-pyrrole-2-carboxylic acid, 5-(p-Tolyl)-1H-pyrrole-2-carboxylic acid, 5-p-tolyl-1 h-pyrrole-2-carboxylic acid, 1H-Pyrrole-2-carboxylic acid, 5-(4-methylphenyl)-, 5- p -Tolyl-1 H -pyrrole-2-carboxylic acid, Oprea1_179438, Oprea1_634042, cid_646320, REGID_for_CID_646320