CAS 131180-63-7 appears in our catalog under these names: (S)-±,±-Bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol, (S)-ALPHA,ALPHA-BIS(3,5-DIMETHYLPHENYL)-. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 10000mg, 5000mg, 500MG.
Bis(3,5-dimethylphenyl)-[(2S)-pyrrolidin-2-yl]methanol (CAS 131180-63-7) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: bis(3,5-dimethylphenyl)-[(2S)-pyrrolidin-2-yl]methanol. InChIKey: MXIOBZPVLNQGIU-FQEVSTJZSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | bis(3,5-dimethylphenyl)-[(2S)-pyrrolidin-2-yl]methanol |
| InChIKey | MXIOBZPVLNQGIU-FQEVSTJZSA-N |
| SMILES | CC1=CC(=CC(=C1)C([C@@H]2CCCN2)(C3=CC(=CC(=C3)C)C)O)C |
Computed by PubChem (NCBI)