CAS 948595-01-5 is the registry number for (R)–α,α–Bis(3,5–dimethylphenyl)–2–pyrrolidinemethanol. Offered by: GLPBio. Available pack sizes: 1g.
Bis(3,5-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanol (CAS 948595-01-5) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: bis(3,5-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanol. InChIKey: MXIOBZPVLNQGIU-HXUWFJFHSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | bis(3,5-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanol |
| InChIKey | MXIOBZPVLNQGIU-HXUWFJFHSA-N |
| SMILES | CC1=CC(=CC(=C1)C([C@H]2CCCN2)(C3=CC(=CC(=C3)C)C)O)C |
Computed by PubChem (NCBI)