Products 1312138-05-8

CAS 1312138-05-8 is the registry number for 3-(6-Chloro-1-methyl-1h-benzimidazol-2-yl)-3-hydroxypropanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(6-chloro-1-methylbenzimidazol-2-yl)-3-hydroxypropanoic acid (CAS 1312138-05-8) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 3-(6-chloro-1-methylbenzimidazol-2-yl)-3-hydroxypropanoic acid. InChIKey: USFDHSIEECKVPR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClN2O3
Molecular weight254.67 g/mol
IUPAC name3-(6-chloro-1-methylbenzimidazol-2-yl)-3-hydroxypropanoic acid
InChIKeyUSFDHSIEECKVPR-UHFFFAOYSA-N
SMILESCN1C2=C(C=CC(=C2)Cl)N=C1C(CC(=O)O)O

Computed by PubChem (NCBI)