CAS 730949-85-6 is the registry number for 2-Chloromethyl-6,7-dimethoxy-3h-quinazolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-(chloromethyl)-6,7-dimethoxy-3H-quinazolin-4-one (CAS 730949-85-6) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 2-(chloromethyl)-6,7-dimethoxy-3H-quinazolin-4-one. InChIKey: JPIPKVHFNPURHB-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 2-(chloromethyl)-6,7-dimethoxy-3H-quinazolin-4-one |
| InChIKey | JPIPKVHFNPURHB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NC(=N2)CCl)OC |
Computed by PubChem (NCBI)