Products 854137-68-1
CAS 854137-68-1 is the registry number for 5-(Chloromethyl)-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
5-(chloromethyl)-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole (CAS 854137-68-1) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 5-(chloromethyl)-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole. InChIKey: PAIAKDQUXNBITM-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | PAIAKDQUXNBITM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NOC(=N2)CCl)OC |
Computed by PubChem (NCBI)