CAS 929973-94-4 appears in our catalog under these names: 1-(Chloroacetyl)-6-nitro-1,2,3,4-tetrahydroquinoline, 95%, 2-Chloro-1-(6-nitro-1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-chloro-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone (CAS 929973-94-4) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 2-chloro-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone. InChIKey: NVQFDNIBMSEAIY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 2-chloro-1-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| InChIKey | NVQFDNIBMSEAIY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)[N+](=O)[O-])N(C1)C(=O)CCl |
Computed by PubChem (NCBI)