Products 696604-74-7
CAS 696604-74-7 appears in our catalog under these names: 2-(Chloromethyl)-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole, 95%, 2-(Chloromethyl)-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(chloromethyl)-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole (CAS 696604-74-7) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 2-(chloromethyl)-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole. InChIKey: MGHSHFKWIHAXBS-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazole |
| InChIKey | MGHSHFKWIHAXBS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN=C(O2)CCl)OC |
Computed by PubChem (NCBI)