CAS 827605-45-8 is the registry number for 4(3H)-Quinazolinone, 2-chloro-6,7-dimethoxy-5-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one (CAS 827605-45-8) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 2-chloro-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one. InChIKey: MCVHVVQWYYBKLR-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 2-chloro-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one |
| InChIKey | MCVHVVQWYYBKLR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C1OC)OC)N=C(NC2=O)Cl |
Computed by PubChem (NCBI)