CAS 13123-00-7 appears in our catalog under these names: Z–Phe–Val–OH, Z-Phe-Val-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 5g, 1g, 2g, 10g.
(2S)-3-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid (CAS 13123-00-7) is a chemical compound with the molecular formula C22H26N2O5 and a molecular weight of 398.5 g/mol. IUPAC name: (2S)-3-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid. InChIKey: AJQYZRHQCXCROF-OALUTQOASA-N.
| Molecular formula | C22H26N2O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid |
| InChIKey | AJQYZRHQCXCROF-OALUTQOASA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)