CAS 19542-51-9 appears in our catalog under these names: Z-Val-phe-oh, 95%, Z-Val-Phe-OH, 98%, Z–Val–Phe–OH, Z-VAL-PHE-OH, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100mg, 250mg, 100g.
(2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoic acid (CAS 19542-51-9) is a chemical compound with the molecular formula C22H26N2O5 and a molecular weight of 398.5 g/mol. IUPAC name: (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoic acid. InChIKey: XINBRUNUJFZFGH-OALUTQOASA-N.
| Molecular formula | C22H26N2O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | XINBRUNUJFZFGH-OALUTQOASA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)