Products 87063-91-0
CAS 87063-91-0 is the registry number for Dibenzyl L-alanyl-L-glutamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibenzyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioate (CAS 87063-91-0) is a chemical compound with the molecular formula C22H26N2O5 and a molecular weight of 398.5 g/mol. IUPAC name: dibenzyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioate. InChIKey: UQRIFZCMNCZLJQ-LPHOPBHVSA-N.
| Molecular formula | C22H26N2O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | dibenzyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioate |
| InChIKey | UQRIFZCMNCZLJQ-LPHOPBHVSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCC(=O)OCC1=CC=CC=C1)C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)