Products 15099-82-8
CAS 15099-82-8 is the registry number for Z-D-Phe-Val-OH. Offered by: Biosynth. Available pack sizes: 2000mg, 5000mg, 10000mg.
(2S)-3-methyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid (CAS 15099-82-8) is a chemical compound with the molecular formula C22H26N2O5 and a molecular weight of 398.5 g/mol. IUPAC name: (2S)-3-methyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid. InChIKey: AJQYZRHQCXCROF-MOPGFXCFSA-N.
| Molecular formula | C22H26N2O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoic acid |
| InChIKey | AJQYZRHQCXCROF-MOPGFXCFSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Z-D-Phe-Val-OH, Cbz-D-Phe-L-Val