Products 319425-66-6
CAS 319425-66-6 appears in our catalog under these names: CF 1743, >95% (HPLC), CF-1743/ 99.16% (existing batch purity), CF 1743-d7 (Major), CF-1743, Cf1743. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 500mg.
3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one (CAS 319425-66-6) is a chemical compound with the molecular formula C22H26N2O5 and a molecular weight of 398.5 g/mol. IUPAC name: 3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one. InChIKey: MFGSDSRTGUVZQG-DFQSSKMNSA-N.
| Molecular formula | C22H26N2O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(4-pentylphenyl)furo[2,3-d]pyrimidin-2-one |
| InChIKey | MFGSDSRTGUVZQG-DFQSSKMNSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C2=CC3=CN(C(=O)N=C3O2)[C@H]4C[C@@H]([C@H](O4)CO)O |
Computed by PubChem (NCBI)