CAS 946123-11-1 appears in our catalog under these names: Coumarin 343 X carboxylic acid, Coumarin 343 X carboxylic acid, 95%, 6-(11-Oxo-2,3,6,7-tetrahydro-1H,5H,11H-pyrano[2,3-f]pyrido[3,2,1-ij]quinoline-10-carboxamido)hexanoic acid, 95%, Coumarin 343 X carboxylic acid. Offered by: GLPBio, Lumiprobe, Chemat Brand, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, on request, Get quote.
6-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]hexanoic acid (CAS 946123-11-1) is a chemical compound with the molecular formula C22H26N2O5 and a molecular weight of 398.5 g/mol. IUPAC name: 6-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]hexanoic acid. InChIKey: HCUGYFCWVUOZRK-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 6-[(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonyl)amino]hexanoic acid |
| InChIKey | HCUGYFCWVUOZRK-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=C4C(=C2)C=C(C(=O)O4)C(=O)NCCCCCC(=O)O)CCCN3C1 |
Computed by PubChem (NCBI)