Products 1312536-58-5
CAS 1312536-58-5 is the registry number for 6-(aminomethyl)-1,2,3,4-tetrahydroquinolin-2-one hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 1g.
6-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride (CAS 1312536-58-5) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 6-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride. InChIKey: DMYSQDRKLSGBNF-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 6-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| InChIKey | DMYSQDRKLSGBNF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)