CAS 1312703-28-8 appears in our catalog under these names: 2'–Amino–(1,1':4',1''–terphenyl)–4,4''–dicarboxylic acid, 2'-Amino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid 98%, 2'-amino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%, 2'-Amino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-[3-amino-4-(4-carboxyphenyl)phenyl]benzoic acid (CAS 1312703-28-8) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: 4-[3-amino-4-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: IONBHNFWEFNUEE-UHFFFAOYSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 4-[3-amino-4-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | IONBHNFWEFNUEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C3=CC=C(C=C3)C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)