CAS 2230912-22-6 appears in our catalog under these names: 5'–Amino–(1,1':3',1''–terphenyl)–4,4''–dicarboxylic acid, 5'-Amino-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid 98%, 5'-Amino-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%, 5'-Amino-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[3-amino-5-(4-carboxyphenyl)phenyl]benzoic acid (CAS 2230912-22-6) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: 4-[3-amino-5-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: IJFVCJQMSQZSGK-UHFFFAOYSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 4-[3-amino-5-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | IJFVCJQMSQZSGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)N)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)