CAS 277309-32-7 is the registry number for 7-((Benzyloxy)methoxy)-3H-phenoxazin-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-(phenylmethoxymethoxy)phenoxazin-3-one (CAS 277309-32-7) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: 7-(phenylmethoxymethoxy)phenoxazin-3-one. InChIKey: UOBJOWXNMYOTGQ-UHFFFAOYSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 7-(phenylmethoxymethoxy)phenoxazin-3-one |
| InChIKey | UOBJOWXNMYOTGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCOC2=CC3=C(C=C2)N=C4C=CC(=O)C=C4O3 |
Computed by PubChem (NCBI)