CAS 1312764-95-6 is the registry number for (3R)-3-Hydroxy-1-((4-methoxyphenyl)methyl)-2,5-pyrrolidinedione. Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.
(3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione (CAS 1312764-95-6) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: (3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione. InChIKey: MMPZOAJGGCUAFV-SNVBAGLBSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
| InChIKey | MMPZOAJGGCUAFV-SNVBAGLBSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C[C@H](C2=O)O |
Computed by PubChem (NCBI)