CAS 13131-02-7 appears in our catalog under these names: 1-phenylpyridin-2(1H)-one, 95%, Pirfenidone Impurity 9. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, on request.
1-phenylpyridin-2-one (CAS 13131-02-7) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-phenylpyridin-2-one. InChIKey: HQWNTNFZAGSJAX-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-phenylpyridin-2-one |
| InChIKey | HQWNTNFZAGSJAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CC=CC2=O |
Computed by PubChem (NCBI)