CAS 1313233-08-7 appears in our catalog under these names: 1-benzyl-1h-1,2,3-triazol-4-amine, 95%, 1-Benzyl-1H-1,2,3-triazol-4-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
1-benzyltriazol-4-amine (CAS 1313233-08-7) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 1-benzyltriazol-4-amine. InChIKey: RBLVYNSMAXMNKV-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-benzyltriazol-4-amine |
| InChIKey | RBLVYNSMAXMNKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=N2)N |
Computed by PubChem (NCBI)