Products 1346606-45-8
CAS 1346606-45-8 appears in our catalog under these names: Z,Z-Dienestrol-d2, >95% (HPLC), Z,Z-Dienestrol-d2, Dienestrol-d2. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 2mg, 25mg, 10mg, 500 μg.
4-[(2Z,4Z)-2,5-dideuterio-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol (CAS 1346606-45-8) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 268.3 g/mol. IUPAC name: 4-[(2Z,4Z)-2,5-dideuterio-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol. InChIKey: NFDFQCUYFHCNBW-RXGZYQEUSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 4-[(2Z,4Z)-2,5-dideuterio-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
| InChIKey | NFDFQCUYFHCNBW-RXGZYQEUSA-N |
| SMILES | [2H]/C(=C(/C(=C(\C)/[2H])/C1=CC=C(C=C1)O)\C2=CC=C(C=C2)O)/C |
Computed by PubChem (NCBI)