Products 35495-11-5
CAS 35495-11-5 appears in our catalog under these names: Z,Z-Dienestrol, >95% (HPLC), Isodienestrol. Offered by: TRC, MedChemExpress. Available pack sizes: 5mg, 5 mg.
4-[(2Z,4Z)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol (CAS 35495-11-5) is a chemical compound with the molecular formula C18H18O2 and a molecular weight of 266.3 g/mol. IUPAC name: 4-[(2Z,4Z)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol. InChIKey: NFDFQCUYFHCNBW-XBMAZEBWSA-N.
| Molecular formula | C18H18O2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | 4-[(2Z,4Z)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
| InChIKey | NFDFQCUYFHCNBW-XBMAZEBWSA-N |
| SMILES | C/C=C(\C(=C/C)\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)
Synonyms:
Z,Z-Dienestrol, Isodienestrol, (Z,Z)-Dienestrol, beta-Dienestrol, 4-[(2Z,4Z)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol, Phenol, 4,4'-((1Z,2Z)-1,2-diethylidene-1,2-ethanediyl)bis-, Z,Z-DIES, Phenol, 4,4'-(1,2-diethylidene-1,2-ethanediyl)bis-, (Z,Z)-, .BETA.-DIENESTROL, CIS,CIS-DIENESTROL