CAS 13142-51-3 appears in our catalog under these names: 1–(2,3–Dichlorophenyl)urea, N-(2,3-Dichlorophenyl)urea, 96.55%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 250mg, 50mg, 25 mg, 50 mg, 100 mg.
(2,3-dichlorophenyl)urea (CAS 13142-51-3) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: (2,3-dichlorophenyl)urea. InChIKey: PEZPHMOCGURMEM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | (2,3-dichlorophenyl)urea |
| InChIKey | PEZPHMOCGURMEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)NC(=O)N |
Computed by PubChem (NCBI)