CAS 1314323-99-3 appears in our catalog under these names: (1R,2S)-2-(4-Methoxyphenyl)cyclopropan-1-amine hydrochloride, 98%, rac-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 5g, 1g.
Trans-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride (CAS 1314323-99-3) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: trans-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: MTAUQORJZLQJGH-BAUSSPIASA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | MTAUQORJZLQJGH-BAUSSPIASA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2C[C@H]2N.Cl |
Computed by PubChem (NCBI)