Products 2271309-68-1
CAS 2271309-68-1 is the registry number for (1S,2R)-2-(4-methoxyphenyl)cyclopropan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1S,2R)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride (CAS 2271309-68-1) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: trans-(1S,2R)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: MTAUQORJZLQJGH-UXQCFNEQSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | trans-(1S,2R)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | MTAUQORJZLQJGH-UXQCFNEQSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2C[C@@H]2N.Cl |
Computed by PubChem (NCBI)