CAS 26568-28-5 appears in our catalog under these names: rel-(1R,2S)-2-(4-Methoxyphenyl)cyclopropan-1-amine hydrochloride, 98%, trans–2–(4–methoxyphenyl)cyclopropan–1–aminehydrochloride, rac-(1R,2S)-2-(4-Methoxyphenyl)cyclopropan-1-amine hydrochloride. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 50mg, 0,5g.
Trans-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride (CAS 26568-28-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: trans-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: MTAUQORJZLQJGH-BAUSSPIASA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-methoxyphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | MTAUQORJZLQJGH-BAUSSPIASA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2C[C@H]2N.Cl |
Computed by PubChem (NCBI)