Products 1314710-36-5
CAS 1314710-36-5 appears in our catalog under these names: 1-(4-Cyanophenyl)cyclobutanecarboxylic Acid, 1-(4-Cyanophenyl)cyclobutanecarboxylic acid, 98%, 1-(4-Cyanophenyl)cyclobutane-1-carboxylic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(4-cyanophenyl)cyclobutane-1-carboxylic acid (CAS 1314710-36-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 1-(4-cyanophenyl)cyclobutane-1-carboxylic acid. InChIKey: VSJSUZJOUXGAFZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-(4-cyanophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | VSJSUZJOUXGAFZ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)