Products 1314775-04-6
CAS 1314775-04-6 appears in our catalog under these names: 1-(4-Chloro-2-methylphenyl)cyclopropane-1-carboxylic acid, 95%, 1-(4-Chloro-2-methylphenyl)cyclopropane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(4-chloro-2-methylphenyl)cyclopropane-1-carboxylic acid (CAS 1314775-04-6) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 1-(4-chloro-2-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: KJOUXBIGBPDTBT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 1-(4-chloro-2-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | KJOUXBIGBPDTBT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C2(CC2)C(=O)O |
Computed by PubChem (NCBI)