Products 13149-00-3
CAS 13149-00-3 appears in our catalog under these names: Cis-1,2-cyclohexanedicarboxylic anhydride, 98%, Perospirone Impurity 5, (3aR,7aS)-rel-Hexahydro-1,3-isobenzofurandione, >95% (HPLC), cis-1,2-Cyclohexanedicarboxylic acid anhydride, cis–1,2–Cyclohexanedicarboxylic anhydride. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 500g, 1kg, 25g, 100g, on request, 50g, 5g, 100mg.
(3aS,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (CAS 13149-00-3) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione. InChIKey: MUTGBJKUEZFXGO-OLQVQODUSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aS,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| InChIKey | MUTGBJKUEZFXGO-OLQVQODUSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C(=O)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
cis-1,2-Cyclohexanedicarboxylic anhydride, cis-Hexahydrophthalic anhydride, 1,3-Isobenzofurandione, hexahydro-, (3aR,7aS)-rel-, Hexahydrophthalic anhydride, cis-, cis-Cyclohexane-1,2-dicarboxylic anhydride, 1,3-Isobenzofurandione, hexahydro-, cis-, 1,2-Cyclohexanedicarboxylic anhydride, cis-, cyclohexanedicarboxylic anhydride, cis-1,2-cyclohexanecarboxylic acid anhydride, 1,3Isobenzofurandione, hexahydro, cis