CAS 31982-85-1 appears in our catalog under these names: (–)–trans–1,2–Cyclohexanedicarboxylic Anhydride, (-)-trans-1,2-Cyclohexanedicarboxylic Anhydride, >98.0%(GC), (-)-trans-1,2-Cyclohexanedicarboxylic Anhydride, (3aS,7aS)-Hexahydroisobenzofuran-1,3-dione 98%, (-)-trans-1,2-Cyclohexanedicarboxylic Anhydride, 95%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg, 500mg, 1000mg.
(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (CAS 31982-85-1) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aS,7aS)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione. InChIKey: MUTGBJKUEZFXGO-WDSKDSINSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aS,7aS)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| InChIKey | MUTGBJKUEZFXGO-WDSKDSINSA-N |
| SMILES | C1CC[C@H]2[C@H](C1)C(=O)OC2=O |
Computed by PubChem (NCBI)