CAS 71749-03-6 appears in our catalog under these names: (+)–trans–1,2–Cyclohexanedicarboxylic Anhydride, (3aR,7aR)-Hexahydroisobenzofuran-1,3-dione 98%, (+)-TRANS-1,2-CYCLOHEXANEDICARBOXYLIC ANHYDRIDE, 98%, 98%, (3aR,7aR)-Hexahydroisobenzofuran-1,3-dione, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (CAS 71749-03-6) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione. InChIKey: MUTGBJKUEZFXGO-PHDIDXHHSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| InChIKey | MUTGBJKUEZFXGO-PHDIDXHHSA-N |
| SMILES | C1CC[C@@H]2[C@@H](C1)C(=O)OC2=O |
Computed by PubChem (NCBI)