CAS 89614-24-4 is the registry number for Hexahydro-1,3-isobenzofurandione-d8. Offered by: TRC. Available pack sizes: 250mg, 25mg.
4,4,5,5,6,6,7,7-octadeuterio-3a,7a-dihydro-2-benzofuran-1,3-dione (CAS 89614-24-4) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 162.21 g/mol. IUPAC name: 4,4,5,5,6,6,7,7-octadeuterio-3a,7a-dihydro-2-benzofuran-1,3-dione. InChIKey: MUTGBJKUEZFXGO-SVYQBANQSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 162.21 g/mol |
| IUPAC name | 4,4,5,5,6,6,7,7-octadeuterio-3a,7a-dihydro-2-benzofuran-1,3-dione |
| InChIKey | MUTGBJKUEZFXGO-SVYQBANQSA-N |
| SMILES | [2H]C1(C2C(C(=O)OC2=O)C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)