CAS 14166-21-3 appears in our catalog under these names: Trans-1,2-cyclohexanedicarboxylic anhydride, 97%, Trans-1,2-cyclohexanedicarboxylic Anhydride, trans-1,2-Cyclohexanedicarboxylic acid anhydride, (±)–trans–1,2–Cyclohexanedicarboxylic Anhydride, (+/-)-trans-1,2-Cyclohexanedicarboxylic Anhydride, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TCI. Available pack sizes: 5g, 100g, 25g, 1g, 100mg.
(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (CAS 14166-21-3) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione. InChIKey: MUTGBJKUEZFXGO-PHDIDXHHSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| InChIKey | MUTGBJKUEZFXGO-PHDIDXHHSA-N |
| SMILES | C1CC[C@@H]2[C@@H](C1)C(=O)OC2=O |
Computed by PubChem (NCBI)